2-(o-tolyloxymethyl)benzoic acid
2-(2-methy1phenoxymethy1)benzioc acid
CAS: 108475-90-7
Molecular Formula: C15H14O3
2-(o-tolyloxymethyl)benzoic acid - Names and Identifiers
| Name | 2-(2-methy1phenoxymethy1)benzioc acid |
| Synonyms | 2-(o-tolyloxymethyl)benzoic acid 2-(2-methy1phenoxymethy1)benzioc acid 2-(2-methy1phenoxymethy1)benzioc acid 2-[(2-Methylphenoxy)methyl]benzoic acid Benzoic acid, 2-[(2-methylphenoxy)methyl]- benzoic acid, 2-[(2-methylphenoxy)methyl]- |
| CAS | 108475-90-7 |
| InChI | InChI=1/C15H14O3/c1-11-6-2-5-9-14(11)18-10-12-7-3-4-8-13(12)15(16)17/h2-9H,10H2,1H3,(H,16,17) |
2-(o-tolyloxymethyl)benzoic acid - Physico-chemical Properties
| Molecular Formula | C15H14O3 |
| Molar Mass | 242.27 |
| Density | 1.193g/cm3 |
| Boling Point | 401.2°C at 760 mmHg |
| Flash Point | 150.7°C |
| Vapor Presure | 3.72E-07mmHg at 25°C |
| Refractive Index | 1.597 |
| Physical and Chemical Properties | Property: off-white solid Melting Point: 152-153 ℃ |
| Use | Pharmaceutical, pesticide intermediates, mainly used for the synthesis of ether ester |
2-(o-tolyloxymethyl)benzoic acid - Reference Information
| uses | pharmaceutical and pesticide intermediates, mainly used in the synthesis of ester of ether |
Last Update：2024-04-09 21:11:58
